C44H26S — CID 171045609
12-(2,3,4,5,6-pentadeuteriophenyl)-4-(3-pyren-1-ylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene (PubChem CID 171045609) has the molecular formula C44H26S and a molecular weight of 591.79 g/mol. Its IUPAC name is 12-(2,3,4,5,6-pentadeuteriophenyl)-4-(3-pyren-1-ylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene.
| Compound Name | 12-(2,3,4,5,6-pentadeuteriophenyl)-4-(3-pyren-1-ylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 171045609 |
| Molecular Formula | C44H26S |
| Molecular Weight | 591.79 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | 12-(2,3,4,5,6-pentadeuteriophenyl)-4-(3-pyren-1-ylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c4c(cccc24)-c2cc(-c4cccc(-c5ccc6ccc7cccc8ccc5c6c78)c4)ccc2S3)c([2H])c1[2H] |
| InChI | InChI=1S/C44H26S/c1-2-7-27(8-3-1)34-22-24-41-44-36(34)13-6-14-37(44)39-26-32(19-23-40(39)45-41)31-11-5-12-33(25-31)35-20-17-30-16-15-28-9-4-10-29-18-21-38(35)43(30)42(28)29/h1-26H/i1D,2D,3D,7D,8D |
| InChIKey | MSKMVSHPQVEJPT-RCQSQLKUSA-N |
| XLogP | 12.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.79 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|