C57H34O — CID 168827446
2,3,5,6-tetradeuterio-4-[1,3,4,5,6,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-2,7-di(pyren-1-yl)fluoren-9-yl]phenol (PubChem CID 168827446) has the molecular formula C57H34O and a molecular weight of 749.99 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-[1,3,4,5,6,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-2,7-di(pyren-1-yl)fluoren-9-yl]phenol.
| Compound Name | 2,3,5,6-tetradeuterio-4-[1,3,4,5,6,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-2,7-di(pyren-1-yl)fluoren-9-yl]phenol |
|---|---|
| PubChem CID | 168827446 |
| Molecular Formula | C57H34O |
| Molecular Weight | 749.99 g/mol |
| Exact Mass | 749.36 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-[1,3,4,5,6,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-2,7-di(pyren-1-yl)fluoren-9-yl]phenol |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3c([2H])c([2H])c(O)c([2H])c3[2H])c3c([2H])c(-c4ccc5ccc6cccc7ccc4c5c67)c([2H])c([2H])c3-c3c([2H])c([2H])c(-c4ccc5ccc6cccc7ccc4c5c67)c([2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C57H34O/c58-44-24-22-43(23-25-44)57(42-10-2-1-3-11-42)51-32-40(45-26-16-38-14-12-34-6-4-8-36-18-30-49(45)55(38)53(34)36)20-28-47(51)48-29-21-41(33-52(48)57)46-27-17-39-15-13-35-7-5-9-37-19-31-50(46)56(39)54(35)37/h1-33,58H/i1D,2D,3D,10D,11D,20D,21D,22D,23D,24D,25D,28D,29D,32D,33D |
| InChIKey | QNSNVFUEKOVPEZ-FEJHDDTISA-N |
| XLogP | 14.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.99 |
| LogP ≤ 5 | 14.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|