C47H31NO — CID 177127333
7-[1,3,4,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,5-tetradeuteriophenyl)xanthen-2-yl]-11-phenylbenzo[a]carbazole (PubChem CID 177127333) has the molecular formula C47H31NO and a molecular weight of 641.87 g/mol. Its IUPAC name is 7-[1,3,4,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,5-tetradeuteriophenyl)xanthen-2-yl]-11-phenylbenzo[a]carbazole.
| Compound Name | 7-[1,3,4,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,5-tetradeuteriophenyl)xanthen-2-yl]-11-phenylbenzo[a]carbazole |
|---|---|
| PubChem CID | 177127333 |
| Molecular Formula | C47H31NO |
| Molecular Weight | 641.87 g/mol |
| Exact Mass | 641.34 |
| IUPAC Name | 7-[1,3,4,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,5-tetradeuteriophenyl)xanthen-2-yl]-11-phenylbenzo[a]carbazole |
| SMILES | [2H]c1cc(C2(c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3c([2H])c([2H])c([2H])c([2H])c3Oc3c([2H])c([2H])c(-c4cccc5c4c4ccc6ccccc6c4n5-c4ccccc4)c([2H])c32)c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C47H31NO/c1-4-16-34(17-5-1)47(35-18-6-2-7-19-35)40-24-12-13-26-43(40)49-44-30-28-33(31-41(44)47)37-23-14-25-42-45(37)39-29-27-32-15-10-11-22-38(32)46(39)48(42)36-20-8-3-9-21-36/h1-31H/i1D,2D,4D,5D,6D,7D,12D,13D,16D,17D,18D,24D,26D,28D,30D,31D |
| InChIKey | GXJHVJVKFUAZRM-RWYBSIIYSA-N |
| XLogP | 12.09 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.87 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |