C43H29NO — CID 177128060
4-(1,3,4,5,6,7,8-heptadeuterio-9,9-diphenylxanthen-2-yl)-9-phenylcarbazole (PubChem CID 177128060) has the molecular formula C43H29NO and a molecular weight of 582.75 g/mol. Its IUPAC name is 4-(1,3,4,5,6,7,8-heptadeuterio-9,9-diphenylxanthen-2-yl)-9-phenylcarbazole.
| Compound Name | 4-(1,3,4,5,6,7,8-heptadeuterio-9,9-diphenylxanthen-2-yl)-9-phenylcarbazole |
|---|---|
| PubChem CID | 177128060 |
| Molecular Formula | C43H29NO |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 4-(1,3,4,5,6,7,8-heptadeuterio-9,9-diphenylxanthen-2-yl)-9-phenylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])Oc1c([2H])c([2H])c(-c3cccc4c3c3ccccc3n4-c3ccccc3)c([2H])c1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H29NO/c1-4-15-31(16-5-1)43(32-17-6-2-7-18-32)36-23-11-13-26-40(36)45-41-28-27-30(29-37(41)43)34-22-14-25-39-42(34)35-21-10-12-24-38(35)44(39)33-19-8-3-9-20-33/h1-29H/i11D,13D,23D,26D,27D,28D,29D |
| InChIKey | IEEQMPJUHPALMP-YZKVLUIGSA-N |
| XLogP | 10.94 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |