C39H29NO — CID 177127059
9-phenyl-3-[2,3,5,6-tetradeuterio-4-[1,3,4,5,6,7,8-heptadeuterio-9,9-bis(trideuteriomethyl)xanthen-2-yl]phenyl]carbazole (PubChem CID 177127059) has the molecular formula C39H29NO and a molecular weight of 544.77 g/mol. Its IUPAC name is 9-phenyl-3-[2,3,5,6-tetradeuterio-4-[1,3,4,5,6,7,8-heptadeuterio-9,9-bis(trideuteriomethyl)xanthen-2-yl]phenyl]carbazole.
| Compound Name | 9-phenyl-3-[2,3,5,6-tetradeuterio-4-[1,3,4,5,6,7,8-heptadeuterio-9,9-bis(trideuteriomethyl)xanthen-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 177127059 |
| Molecular Formula | C39H29NO |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 9-phenyl-3-[2,3,5,6-tetradeuterio-4-[1,3,4,5,6,7,8-heptadeuterio-9,9-bis(trideuteriomethyl)xanthen-2-yl]phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])Oc1c([2H])c([2H])c(-c3c([2H])c([2H])c(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)c([2H])c3[2H])c([2H])c1C2(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C39H29NO/c1-39(2)33-13-7-9-15-37(33)41-38-23-21-29(25-34(38)39)27-18-16-26(17-19-27)28-20-22-36-32(24-28)31-12-6-8-14-35(31)40(36)30-10-4-3-5-11-30/h3-25H,1-2H3/i1D3,2D3,7D,9D,13D,15D,16D,17D,18D,19D,21D,23D,25D |
| InChIKey | PIVIRGUYKPMMME-UDVZFFGBSA-N |
| XLogP | 10.55 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |