C43H27NO — CID 177299189
3-(1,1',2,3,3',4,4',5,5',6,6',7,7',8,8'-pentadecadeuteriospiro[fluorene-9,9'-xanthene]-2'-yl)-9-phenylcarbazole (PubChem CID 177299189) has the molecular formula C43H27NO and a molecular weight of 588.79 g/mol. Its IUPAC name is 3-(1,1',2,3,3',4,4',5,5',6,6',7,7',8,8'-pentadecadeuteriospiro[fluorene-9,9'-xanthene]-2'-yl)-9-phenylcarbazole.
| Compound Name | 3-(1,1',2,3,3',4,4',5,5',6,6',7,7',8,8'-pentadecadeuteriospiro[fluorene-9,9'-xanthene]-2'-yl)-9-phenylcarbazole |
|---|---|
| PubChem CID | 177299189 |
| Molecular Formula | C43H27NO |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 3-(1,1',2,3,3',4,4',5,5',6,6',7,7',8,8'-pentadecadeuteriospiro[fluorene-9,9'-xanthene]-2'-yl)-9-phenylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])Oc1c([2H])c([2H])c(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)c([2H])c1C21c2c([2H])c([2H])c([2H])c([2H])c2-c2c([2H])c([2H])c([2H])c([2H])c21 |
| InChI | InChI=1S/C43H27NO/c1-2-12-30(13-3-1)44-39-20-10-6-16-33(39)34-26-28(22-24-40(34)44)29-23-25-42-38(27-29)43(37-19-9-11-21-41(37)45-42)35-17-7-4-14-31(35)32-15-5-8-18-36(32)43/h1-27H/i4D,5D,7D,8D,9D,11D,14D,15D,17D,18D,19D,21D,23D,25D,27D |
| InChIKey | HUDWKKCUZSBSNT-SPQAJZDSSA-N |
| XLogP | 10.92 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |