C37H27NO — CID 177127406
8-(1,3,4,5,6,7,8-heptadeuterio-9,9-dimethylxanthen-2-yl)-11-phenylbenzo[a]carbazole (PubChem CID 177127406) has the molecular formula C37H27NO and a molecular weight of 508.67 g/mol. Its IUPAC name is 8-(1,3,4,5,6,7,8-heptadeuterio-9,9-dimethylxanthen-2-yl)-11-phenylbenzo[a]carbazole.
| Compound Name | 8-(1,3,4,5,6,7,8-heptadeuterio-9,9-dimethylxanthen-2-yl)-11-phenylbenzo[a]carbazole |
|---|---|
| PubChem CID | 177127406 |
| Molecular Formula | C37H27NO |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 8-(1,3,4,5,6,7,8-heptadeuterio-9,9-dimethylxanthen-2-yl)-11-phenylbenzo[a]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])Oc1c([2H])c([2H])c(-c3ccc4c(c3)c3ccc5ccccc5c3n4-c3ccccc3)c([2H])c1C2(C)C |
| InChI | InChI=1S/C37H27NO/c1-37(2)31-14-8-9-15-34(31)39-35-21-18-26(23-32(35)37)25-17-20-33-30(22-25)29-19-16-24-10-6-7-13-28(24)36(29)38(33)27-11-4-3-5-12-27/h3-23H,1-2H3/i8D,9D,14D,15D,18D,21D,23D |
| InChIKey | DIZHKDLTVXVRAD-MMSQBFPYSA-N |
| XLogP | 10.04 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |