C49H33NO — CID 177127215
3-[4-[1,3,4,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,5-tetradeuteriophenyl)xanthen-2-yl]phenyl]-9-phenylcarbazole (PubChem CID 177127215) has the molecular formula C49H33NO and a molecular weight of 667.91 g/mol. Its IUPAC name is 3-[4-[1,3,4,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,5-tetradeuteriophenyl)xanthen-2-yl]phenyl]-9-phenylcarbazole.
| Compound Name | 3-[4-[1,3,4,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,5-tetradeuteriophenyl)xanthen-2-yl]phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 177127215 |
| Molecular Formula | C49H33NO |
| Molecular Weight | 667.91 g/mol |
| Exact Mass | 667.36 |
| IUPAC Name | 3-[4-[1,3,4,5,6,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,5-tetradeuteriophenyl)xanthen-2-yl]phenyl]-9-phenylcarbazole |
| SMILES | [2H]c1cc(C2(c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3c([2H])c([2H])c([2H])c([2H])c3Oc3c([2H])c([2H])c(-c4ccc(-c5ccc6c(c5)c5ccccc5n6-c5ccccc5)cc4)c([2H])c32)c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C49H33NO/c1-4-14-38(15-5-1)49(39-16-6-2-7-17-39)43-21-11-13-23-47(43)51-48-31-29-37(33-44(48)49)35-26-24-34(25-27-35)36-28-30-46-42(32-36)41-20-10-12-22-45(41)50(46)40-18-8-3-9-19-40/h1-33H/i1D,2D,4D,5D,6D,7D,11D,13D,14D,15D,16D,21D,23D,29D,31D,33D |
| InChIKey | BDUUMFLFWXNPLA-GNJQHQJZSA-N |
| XLogP | 12.61 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.91 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |