C49H31NO — CID 177128020
9-phenyl-3-[2,3,4,6-tetradeuterio-5-(1',3',4',5',6',7',8'-heptadeuteriospiro[fluorene-9,9'-xanthene]-2'-yl)phenyl]carbazole (PubChem CID 177128020) has the molecular formula C49H31NO and a molecular weight of 660.86 g/mol. Its IUPAC name is 9-phenyl-3-[2,3,4,6-tetradeuterio-5-(1',3',4',5',6',7',8'-heptadeuteriospiro[fluorene-9,9'-xanthene]-2'-yl)phenyl]carbazole.
| Compound Name | 9-phenyl-3-[2,3,4,6-tetradeuterio-5-(1',3',4',5',6',7',8'-heptadeuteriospiro[fluorene-9,9'-xanthene]-2'-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 177128020 |
| Molecular Formula | C49H31NO |
| Molecular Weight | 660.86 g/mol |
| Exact Mass | 660.31 |
| IUPAC Name | 9-phenyl-3-[2,3,4,6-tetradeuterio-5-(1',3',4',5',6',7',8'-heptadeuteriospiro[fluorene-9,9'-xanthene]-2'-yl)phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])Oc1c([2H])c([2H])c(-c3c([2H])c([2H])c([2H])c(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)c3[2H])c([2H])c1C21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C49H31NO/c1-2-15-36(16-3-1)50-45-23-10-6-19-39(45)40-30-34(25-27-46(40)50)32-13-12-14-33(29-32)35-26-28-48-44(31-35)49(43-22-9-11-24-47(43)51-48)41-20-7-4-17-37(41)38-18-5-8-21-42(38)49/h1-31H/i9D,11D,12D,13D,14D,22D,24D,26D,28D,29D,31D |
| InChIKey | SDWYIQWYSOSKMP-WSKZJTMVSA-N |
| XLogP | 12.59 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.86 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |