C48H34N2 — CID 165384217
2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)-N,N-bis[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline (PubChem CID 165384217) has the molecular formula C48H34N2 and a molecular weight of 660.95 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)-N,N-bis[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline.
| Compound Name | 2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)-N,N-bis[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 165384217 |
| Molecular Formula | C48H34N2 |
| Molecular Weight | 660.95 g/mol |
| Exact Mass | 660.41 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)-N,N-bis[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3c([2H])c([2H])c(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])c([2H])c3[2H])c3c([2H])c([2H])c([2H])c(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)c3[2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C48H34N2/c1-4-13-35(14-5-1)37-23-28-42(29-24-37)49(43-30-25-38(26-31-43)36-15-6-2-7-16-36)44-20-12-17-39(33-44)40-27-32-48-46(34-40)45-21-10-11-22-47(45)50(48)41-18-8-3-9-19-41/h1-34H/i1D,2D,4D,5D,6D,7D,12D,13D,14D,15D,16D,17D,20D,23D,24D,25D,26D,28D,29D,30D,31D,33D |
| InChIKey | QGASXPAGHAGIKJ-CYPFVOQQSA-N |
| XLogP | 13.25 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.95 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |