C60H42N2 — CID 165384039
2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)-N,N-bis[4-(4-phenylphenyl)phenyl]aniline (PubChem CID 165384039) has the molecular formula C60H42N2 and a molecular weight of 795.03 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)-N,N-bis[4-(4-phenylphenyl)phenyl]aniline.
| Compound Name | 2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)-N,N-bis[4-(4-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 165384039 |
| Molecular Formula | C60H42N2 |
| Molecular Weight | 795.03 g/mol |
| Exact Mass | 794.36 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)-N,N-bis[4-(4-phenylphenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(-c2ccc3c(c2)c2ccccc2n3-c2ccccc2)c([2H])c(N(c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)c1[2H] |
| InChI | InChI=1S/C60H42N2/c1-4-13-43(14-5-1)45-23-27-47(28-24-45)49-31-36-54(37-32-49)61(55-38-33-50(34-39-55)48-29-25-46(26-30-48)44-15-6-2-7-16-44)56-20-12-17-51(41-56)52-35-40-60-58(42-52)57-21-10-11-22-59(57)62(60)53-18-8-3-9-19-53/h1-42H/i12D,17D,20D,41D |
| InChIKey | WVRNWCULTVFVCT-FYWYBXIBSA-N |
| XLogP | 16.59 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.03 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |