C26H17Cl — CID 169040063
1-[6-(3-chlorophenyl)naphthalen-2-yl]-2,3,4,5,6,7,8-heptadeuterionaphthalene (PubChem CID 169040063) has the molecular formula C26H17Cl and a molecular weight of 371.92 g/mol. Its IUPAC name is 1-[6-(3-chlorophenyl)naphthalen-2-yl]-2,3,4,5,6,7,8-heptadeuterionaphthalene.
| Compound Name | 1-[6-(3-chlorophenyl)naphthalen-2-yl]-2,3,4,5,6,7,8-heptadeuterionaphthalene |
|---|---|
| PubChem CID | 169040063 |
| Molecular Formula | C26H17Cl |
| Molecular Weight | 371.92 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[6-(3-chlorophenyl)naphthalen-2-yl]-2,3,4,5,6,7,8-heptadeuterionaphthalene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4cc(-c5cccc(Cl)c5)ccc4c3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C26H17Cl/c27-24-8-3-7-19(17-24)20-11-12-22-16-23(14-13-21(22)15-20)26-10-4-6-18-5-1-2-9-25(18)26/h1-17H/i1D,2D,4D,5D,6D,9D,10D |
| InChIKey | QHDLDDQKYIOLQS-SIBVXZQBSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.92 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |