C28H17ClO — CID 171731297
1-[6-(3-chlorophenyl)naphthalen-2-yl]-2,3,4,6,7,8,9-heptadeuteriodibenzofuran (PubChem CID 171731297) has the molecular formula C28H17ClO and a molecular weight of 411.94 g/mol. Its IUPAC name is 1-[6-(3-chlorophenyl)naphthalen-2-yl]-2,3,4,6,7,8,9-heptadeuteriodibenzofuran.
| Compound Name | 1-[6-(3-chlorophenyl)naphthalen-2-yl]-2,3,4,6,7,8,9-heptadeuteriodibenzofuran |
|---|---|
| PubChem CID | 171731297 |
| Molecular Formula | C28H17ClO |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 1-[6-(3-chlorophenyl)naphthalen-2-yl]-2,3,4,6,7,8,9-heptadeuteriodibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c([2H])c(-c4ccc5cc(-c6cccc(Cl)c6)ccc5c4)c32)c1[2H] |
| InChI | InChI=1S/C28H17ClO/c29-23-6-3-5-18(17-23)19-11-12-21-16-22(14-13-20(21)15-19)24-8-4-10-27-28(24)25-7-1-2-9-26(25)30-27/h1-17H/i1D,2D,4D,7D,8D,9D,10D |
| InChIKey | ZBBPKFLUEMAZCE-ZVFOJVEISA-N |
| XLogP | 8.73 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |