C50H33NO — CID 170541900
4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N,N-bis[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]aniline (PubChem CID 170541900) has the molecular formula C50H33NO and a molecular weight of 684.95 g/mol. Its IUPAC name is 4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N,N-bis[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]aniline.
| Compound Name | 4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N,N-bis[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]aniline |
|---|---|
| PubChem CID | 170541900 |
| Molecular Formula | C50H33NO |
| Molecular Weight | 684.95 g/mol |
| Exact Mass | 684.39 |
| IUPAC Name | 4-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N,N-bis[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c([2H])c(-c4ccc(N(c5ccc(-c6c([2H])c([2H])c([2H])c7c([2H])c([2H])c([2H])c([2H])c67)cc5)c5ccc(-c6c([2H])c([2H])c([2H])c7c([2H])c([2H])c([2H])c([2H])c67)cc5)cc4)c32)c1[2H] |
| InChI | InChI=1S/C50H33NO/c1-3-14-42-34(10-1)12-7-17-44(42)36-22-28-39(29-23-36)51(40-30-24-37(25-31-40)45-18-8-13-35-11-2-4-15-43(35)45)41-32-26-38(27-33-41)46-19-9-21-49-50(46)47-16-5-6-20-48(47)52-49/h1-33H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D,18D,19D,20D,21D |
| InChIKey | OQWRKZIZJHWWDI-DWNMPCLQSA-N |
| XLogP | 14.36 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.95 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |