C36H23NO2 — CID 177095749
2,3,4,6,7,8,9-heptadeuterio-N-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(4-phenylphenyl)dibenzofuran-1-amine (PubChem CID 177095749) has the molecular formula C36H23NO2 and a molecular weight of 515.67 g/mol. Its IUPAC name is 2,3,4,6,7,8,9-heptadeuterio-N-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(4-phenylphenyl)dibenzofuran-1-amine.
| Compound Name | 2,3,4,6,7,8,9-heptadeuterio-N-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(4-phenylphenyl)dibenzofuran-1-amine |
|---|---|
| PubChem CID | 177095749 |
| Molecular Formula | C36H23NO2 |
| Molecular Weight | 515.67 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 2,3,4,6,7,8,9-heptadeuterio-N-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(4-phenylphenyl)dibenzofuran-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c([2H])c(N(c4ccc(-c5ccccc5)cc4)c4c([2H])c([2H])c([2H])c5oc6c([2H])c([2H])c([2H])c([2H])c6c45)c32)c1[2H] |
| InChI | InChI=1S/C36H23NO2/c1-2-10-24(11-3-1)25-20-22-26(23-21-25)37(29-14-8-18-33-35(29)27-12-4-6-16-31(27)38-33)30-15-9-19-34-36(30)28-13-5-7-17-32(28)39-34/h1-23H/i4D,5D,6D,7D,8D,9D,12D,13D,14D,15D,16D,17D,18D,19D |
| InChIKey | WJFCKNNPKFWNFT-WOAJUABWSA-N |
| XLogP | 10.62 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.67 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |