C42H30N4O — CID 171726928
4-(9,9-dimethylfluoren-3-yl)-N-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-amine (PubChem CID 171726928) has the molecular formula C42H30N4O and a molecular weight of 618.80 g/mol. Its IUPAC name is 4-(9,9-dimethylfluoren-3-yl)-N-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(9,9-dimethylfluoren-3-yl)-N-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 171726928 |
| Molecular Formula | C42H30N4O |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 4-(9,9-dimethylfluoren-3-yl)-N-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-N-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2nc(-c3ccccc3)nc(-c3ccc4c(c3)-c3ccccc3C4(C)C)n2)c2c([2H])c([2H])c([2H])c3oc4c([2H])c([2H])c([2H])c([2H])c4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C42H30N4O/c1-42(2)33-20-11-9-18-30(33)32-26-28(24-25-34(32)42)40-43-39(27-14-5-3-6-15-27)44-41(45-40)46(29-16-7-4-8-17-29)35-21-13-23-37-38(35)31-19-10-12-22-36(31)47-37/h3-26H,1-2H3/i4D,7D,8D,10D,12D,13D,16D,17D,19D,21D,22D,23D |
| InChIKey | KRQFVCGZIMIZTA-HATUZWNWSA-N |
| XLogP | 10.88 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.80 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |