C51H37NO — CID 177069522
2,3,6,7,8,9-hexadeuterio-N-(9,9-dimethylfluoren-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(4-phenylphenyl)phenyl]dibenzofuran-1-amine (PubChem CID 177069522) has the molecular formula C51H37NO and a molecular weight of 690.93 g/mol. Its IUPAC name is 2,3,6,7,8,9-hexadeuterio-N-(9,9-dimethylfluoren-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(4-phenylphenyl)phenyl]dibenzofuran-1-amine.
| Compound Name | 2,3,6,7,8,9-hexadeuterio-N-(9,9-dimethylfluoren-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(4-phenylphenyl)phenyl]dibenzofuran-1-amine |
|---|---|
| PubChem CID | 177069522 |
| Molecular Formula | C51H37NO |
| Molecular Weight | 690.93 g/mol |
| Exact Mass | 690.36 |
| IUPAC Name | 2,3,6,7,8,9-hexadeuterio-N-(9,9-dimethylfluoren-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(4-phenylphenyl)phenyl]dibenzofuran-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3ccc(-c4ccc(-c5ccccc5)cc4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3c2oc2c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C51H37NO/c1-51(2)45-19-11-9-17-42(45)43-30-29-40(33-46(43)51)52(39-27-25-37(26-28-39)36-23-21-35(22-24-36)34-13-5-3-6-14-34)47-32-31-41(38-15-7-4-8-16-38)50-49(47)44-18-10-12-20-48(44)53-50/h3-33H,1-2H3/i4D,7D,8D,10D,12D,15D,16D,18D,20D,31D,32D |
| InChIKey | AIGRCOJHFAFSEO-QKRBVPFMSA-N |
| XLogP | 14.36 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.93 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |