C55H39NO — CID 167403290
9,9-dimethyl-N-[4-[8-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-5-yl]phenyl]-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 167403290) has the molecular formula C55H39NO and a molecular weight of 734.95 g/mol. Its IUPAC name is 9,9-dimethyl-N-[4-[8-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-5-yl]phenyl]-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[4-[8-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-5-yl]phenyl]-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 167403290 |
| Molecular Formula | C55H39NO |
| Molecular Weight | 734.95 g/mol |
| Exact Mass | 734.33 |
| IUPAC Name | 9,9-dimethyl-N-[4-[8-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-5-yl]phenyl]-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3oc4c5ccccc5c(-c5ccc(N(c6ccc(-c7ccccc7)cc6)c6ccc7c(c6)C(C)(C)c6ccccc6-7)cc5)cc4c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C55H39NO/c1-55(2)51-20-12-11-18-45(51)46-31-30-43(34-52(46)55)56(41-26-21-38(22-27-41)36-13-5-3-6-14-36)42-28-23-39(24-29-42)48-35-50-49-33-40(37-15-7-4-8-16-37)25-32-53(49)57-54(50)47-19-10-9-17-44(47)48/h3-35H,1-2H3/i4D,7D,8D,15D,16D |
| InChIKey | IMMOKYDKCZQEJV-BXVVSGDZSA-N |
| XLogP | 15.52 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.95 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |