C46H31NO — CID 167402855
N-[4-[5-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-8-yl]phenyl]-N,4-diphenylaniline (PubChem CID 167402855) has the molecular formula C46H31NO and a molecular weight of 618.79 g/mol. Its IUPAC name is N-[4-[5-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-8-yl]phenyl]-N,4-diphenylaniline.
| Compound Name | N-[4-[5-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-8-yl]phenyl]-N,4-diphenylaniline |
|---|---|
| PubChem CID | 167402855 |
| Molecular Formula | C46H31NO |
| Molecular Weight | 618.79 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | N-[4-[5-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-8-yl]phenyl]-N,4-diphenylaniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc3c4cc(-c5ccc(N(c6ccccc6)c6ccc(-c7ccccc7)cc6)cc5)ccc4oc3c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C46H31NO/c1-4-12-32(13-5-1)33-20-25-38(26-21-33)47(37-16-8-3-9-17-37)39-27-22-34(23-28-39)36-24-29-45-43(30-36)44-31-42(35-14-6-2-7-15-35)40-18-10-11-19-41(40)46(44)48-45/h1-31H/i2D,6D,7D,14D,15D |
| InChIKey | FKLCFIMAFUBAIA-MXVPXNJSSA-N |
| XLogP | 13.21 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.79 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |