C39H29NO — CID 171589084
2,3,4,6,7,8,9-heptadeuterio-N-(9,9-dimethylfluoren-1-yl)-N-(4-phenylphenyl)dibenzofuran-1-amine (PubChem CID 171589084) has the molecular formula C39H29NO and a molecular weight of 534.71 g/mol. Its IUPAC name is 2,3,4,6,7,8,9-heptadeuterio-N-(9,9-dimethylfluoren-1-yl)-N-(4-phenylphenyl)dibenzofuran-1-amine.
| Compound Name | 2,3,4,6,7,8,9-heptadeuterio-N-(9,9-dimethylfluoren-1-yl)-N-(4-phenylphenyl)dibenzofuran-1-amine |
|---|---|
| PubChem CID | 171589084 |
| Molecular Formula | C39H29NO |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 2,3,4,6,7,8,9-heptadeuterio-N-(9,9-dimethylfluoren-1-yl)-N-(4-phenylphenyl)dibenzofuran-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c([2H])c(N(c4ccc(-c5ccccc5)cc4)c4cccc5c4C(C)(C)c4ccccc4-5)c32)c1[2H] |
| InChI | InChI=1S/C39H29NO/c1-39(2)32-17-8-6-14-29(32)30-16-10-19-34(38(30)39)40(28-24-22-27(23-25-28)26-12-4-3-5-13-26)33-18-11-21-36-37(33)31-15-7-9-20-35(31)41-36/h3-25H,1-2H3/i7D,9D,11D,15D,18D,20D,21D |
| InChIKey | GMIGIHXAEXKLFS-ZSZYEEOOSA-N |
| XLogP | 11.03 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |