C49H31NO — CID 177095708
2,3,4,6,7,8,9-heptadeuterio-N-phenyl-N-[3-(9,9'-spirobi[fluorene]-4'-yl)phenyl]dibenzofuran-1-amine (PubChem CID 177095708) has the molecular formula C49H31NO and a molecular weight of 656.84 g/mol. Its IUPAC name is 2,3,4,6,7,8,9-heptadeuterio-N-phenyl-N-[3-(9,9'-spirobi[fluorene]-4'-yl)phenyl]dibenzofuran-1-amine.
| Compound Name | 2,3,4,6,7,8,9-heptadeuterio-N-phenyl-N-[3-(9,9'-spirobi[fluorene]-4'-yl)phenyl]dibenzofuran-1-amine |
|---|---|
| PubChem CID | 177095708 |
| Molecular Formula | C49H31NO |
| Molecular Weight | 656.84 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | 2,3,4,6,7,8,9-heptadeuterio-N-phenyl-N-[3-(9,9'-spirobi[fluorene]-4'-yl)phenyl]dibenzofuran-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c([2H])c(N(c4ccccc4)c4cccc(-c5cccc6c5-c5ccccc5C65c6ccccc6-c6ccccc65)c4)c32)c1[2H] |
| InChI | InChI=1S/C49H31NO/c1-2-16-33(17-3-1)50(44-28-14-30-46-48(44)39-22-7-11-29-45(39)51-46)34-18-12-15-32(31-34)35-23-13-27-43-47(35)38-21-6-10-26-42(38)49(43)40-24-8-4-19-36(40)37-20-5-9-25-41(37)49/h1-31H/i7D,11D,14D,22D,28D,29D,30D |
| InChIKey | XRYHSVZCWKFTKI-BNZCLNPHSA-N |
| XLogP | 13.07 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.84 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |