C59H41NO — CID 170675074
9,9-dimethyl-N-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-7-yl]naphthalen-1-yl]-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 170675074) has the molecular formula C59H41NO and a molecular weight of 785.01 g/mol. Its IUPAC name is 9,9-dimethyl-N-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-7-yl]naphthalen-1-yl]-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-7-yl]naphthalen-1-yl]-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 170675074 |
| Molecular Formula | C59H41NO |
| Molecular Weight | 785.01 g/mol |
| Exact Mass | 784.35 |
| IUPAC Name | 9,9-dimethyl-N-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)naphtho[1,2-b][1]benzofuran-7-yl]naphthalen-1-yl]-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccccc34)c3c2oc2c4ccccc4ccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C59H41NO/c1-59(2)53-24-14-13-22-48(53)49-32-30-43(37-54(49)59)60(42-28-25-39(26-29-42)38-15-5-3-6-16-38)55-36-35-47(46-21-11-12-23-50(46)55)51-34-33-45(40-17-7-4-8-18-40)58-56(51)52-31-27-41-19-9-10-20-44(41)57(52)61-58/h3-37H,1-2H3/i4D,7D,8D,17D,18D |
| InChIKey | UZUQZWPDDUGVGY-FBWFSGKPSA-N |
| XLogP | 16.67 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.01 |
| LogP ≤ 5 | 16.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |