C62H43NO — CID 177121585
1,2,3,5,6,7,8-heptadeuterio-N-(9,9-dimethylfluoren-2-yl)-N-(4-naphtho[1,2-b][1]benzofuran-10-ylphenyl)-9,9-diphenylfluoren-4-amine (PubChem CID 177121585) has the molecular formula C62H43NO and a molecular weight of 825.07 g/mol. Its IUPAC name is 1,2,3,5,6,7,8-heptadeuterio-N-(9,9-dimethylfluoren-2-yl)-N-(4-naphtho[1,2-b][1]benzofuran-10-ylphenyl)-9,9-diphenylfluoren-4-amine.
| Compound Name | 1,2,3,5,6,7,8-heptadeuterio-N-(9,9-dimethylfluoren-2-yl)-N-(4-naphtho[1,2-b][1]benzofuran-10-ylphenyl)-9,9-diphenylfluoren-4-amine |
|---|---|
| PubChem CID | 177121585 |
| Molecular Formula | C62H43NO |
| Molecular Weight | 825.07 g/mol |
| Exact Mass | 824.38 |
| IUPAC Name | 1,2,3,5,6,7,8-heptadeuterio-N-(9,9-dimethylfluoren-2-yl)-N-(4-naphtho[1,2-b][1]benzofuran-10-ylphenyl)-9,9-diphenylfluoren-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1c(N(c3ccc(-c4cccc5c4oc4c6ccccc6ccc54)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c([2H])c([2H])c([2H])c1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C62H43NO/c1-61(2)53-27-13-11-23-48(53)49-38-36-45(39-56(49)61)63(44-34-31-41(32-35-44)47-25-15-26-50-51-37-33-40-17-9-10-22-46(40)60(51)64-59(47)50)57-30-16-29-55-58(57)52-24-12-14-28-54(52)62(55,42-18-5-3-6-19-42)43-20-7-4-8-21-43/h3-39H,1-2H3/i12D,14D,16D,24D,28D,29D,30D |
| InChIKey | ULSWCFBMXQKCLQ-UCTFXECESA-N |
| XLogP | 16.55 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.07 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |