C47H33NO — CID 167330314
N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(3-naphtho[1,2-b][1]benzofuran-7-ylphenyl)fluoren-2-amine (PubChem CID 167330314) has the molecular formula C47H33NO and a molecular weight of 634.83 g/mol. Its IUPAC name is N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(3-naphtho[1,2-b][1]benzofuran-7-ylphenyl)fluoren-2-amine.
| Compound Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(3-naphtho[1,2-b][1]benzofuran-7-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 167330314 |
| Molecular Formula | C47H33NO |
| Molecular Weight | 634.83 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(3-naphtho[1,2-b][1]benzofuran-7-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(N(c3cccc(-c4cccc5oc6c7ccccc7ccc6c45)c3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C47H33NO/c1-47(2)41-21-8-7-19-38(41)39-27-25-34(29-42(39)47)48(43-22-10-14-30-12-3-5-17-35(30)43)33-16-9-15-32(28-33)36-20-11-23-44-45(36)40-26-24-31-13-4-6-18-37(31)46(40)49-44/h3-29H,1-2H3/i3D,5D,10D,12D,14D,17D,22D |
| InChIKey | SVKKWLBOXUPTSQ-QOTJBOAYSA-N |
| XLogP | 13.34 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.83 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |