C41H31N — CID 171452884
N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(3-naphthalen-1-ylphenyl)fluoren-2-amine (PubChem CID 171452884) has the molecular formula C41H31N and a molecular weight of 544.75 g/mol. Its IUPAC name is N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(3-naphthalen-1-ylphenyl)fluoren-2-amine.
| Compound Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(3-naphthalen-1-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 171452884 |
| Molecular Formula | C41H31N |
| Molecular Weight | 544.75 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(3-naphthalen-1-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(N(c3cccc(-c4cccc5ccccc45)c3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C41H31N/c1-41(2)38-22-8-7-20-36(38)37-25-24-32(27-39(37)41)42(40-23-11-15-29-13-4-6-19-35(29)40)31-17-9-16-30(26-31)34-21-10-14-28-12-3-5-18-33(28)34/h3-27H,1-2H3/i4D,6D,11D,13D,15D,19D,23D |
| InChIKey | FMMJHTRJQOUQSA-XWLHZVFPSA-N |
| XLogP | 11.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.75 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |