C43H33N — CID 171451823
9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine (PubChem CID 171451823) has the molecular formula C43H33N and a molecular weight of 576.82 g/mol. Its IUPAC name is 9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 171451823 |
| Molecular Formula | C43H33N |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.34 |
| IUPAC Name | 9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3c([2H])c([2H])c([2H])c(-c4cccc5ccccc45)c3[2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C43H33N/c1-43(2)41-21-9-8-19-39(41)40-27-26-36(29-42(40)43)44(34-24-22-31(23-25-34)30-12-4-3-5-13-30)35-17-10-16-33(28-35)38-20-11-15-32-14-6-7-18-37(32)38/h3-29H,1-2H3/i3D,4D,5D,10D,12D,13D,16D,17D,22D,23D,24D,25D,28D |
| InChIKey | KTYRVEPOFNDDTK-VLGLLGHISA-N |
| XLogP | 11.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |