C52H41N — CID 171452358
9,9-dimethyl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)fluoren-2-amine (PubChem CID 171452358) has the molecular formula C52H41N and a molecular weight of 687.96 g/mol. Its IUPAC name is 9,9-dimethyl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 171452358 |
| Molecular Formula | C52H41N |
| Molecular Weight | 687.96 g/mol |
| Exact Mass | 687.37 |
| IUPAC Name | 9,9-dimethyl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(-c2cccc3ccccc23)c([2H])c(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2c([2H])c([2H])c(-c3cccc4c3C(C)(C)c3ccccc3-4)c([2H])c2[2H])c1[2H] |
| InChI | InChI=1S/C52H41N/c1-51(2)47-24-9-7-19-43(47)45-31-30-39(33-49(45)51)53(38-17-11-16-36(32-38)41-21-12-15-34-14-5-6-18-40(34)41)37-28-26-35(27-29-37)42-22-13-23-46-44-20-8-10-25-48(44)52(3,4)50(42)46/h5-33H,1-4H3/i11D,16D,17D,26D,27D,28D,29D,32D |
| InChIKey | DBPXBXRAVULZDH-AMNZIHKSSA-N |
| XLogP | 14.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.96 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |