C55H41N — CID 171452730
2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)-N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]aniline (PubChem CID 171452730) has the molecular formula C55H41N and a molecular weight of 723.99 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)-N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)-N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]aniline |
|---|---|
| PubChem CID | 171452730 |
| Molecular Formula | C55H41N |
| Molecular Weight | 723.99 g/mol |
| Exact Mass | 723.37 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)-N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccccc3)cc2)c2c([2H])c([2H])c(-c3cccc4c3C(C)(C)c3ccccc3-4)c([2H])c2[2H])c([2H])c([2H])c1-c1cccc(-c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C55H41N/c1-55(2)53-24-9-8-20-51(53)52-23-12-22-50(54(52)55)42-29-35-47(36-30-42)56(45-31-25-39(26-32-45)38-13-4-3-5-14-38)46-33-27-40(28-34-46)43-17-10-18-44(37-43)49-21-11-16-41-15-6-7-19-48(41)49/h3-37H,1-2H3/i27D,28D,29D,30D,33D,34D,35D,36D |
| InChIKey | PGDIBNDANWUZKJ-NGKNFPSBSA-N |
| XLogP | 15.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.99 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |