C61H45N — CID 171451147
2,3,5,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-4-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]aniline (PubChem CID 171451147) has the molecular formula C61H45N and a molecular weight of 800.09 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-4-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-4-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 171451147 |
| Molecular Formula | C61H45N |
| Molecular Weight | 800.09 g/mol |
| Exact Mass | 799.41 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-4-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc4c3C(C)(C)c3ccccc3-4)cc2)c2c([2H])c([2H])c(-c3cccc(-c4ccc5ccccc5c4)c3)c([2H])c2[2H])c([2H])c([2H])c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C61H45N/c1-61(2)59-21-9-8-18-57(59)58-20-11-19-56(60(58)61)48-32-38-55(39-33-48)62(53-34-28-46(29-35-53)45-24-22-44(23-25-45)42-12-4-3-5-13-42)54-36-30-47(31-37-54)50-16-10-17-51(40-50)52-27-26-43-14-6-7-15-49(43)41-52/h3-41H,1-2H3/i28D,29D,30D,31D,34D,35D,36D,37D |
| InChIKey | JLQWRYUXAKMBSX-IKTJJIFUSA-N |
| XLogP | 16.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.09 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |