C55H41N — CID 171452874
2,3,4,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-5-naphthalen-2-yl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline (PubChem CID 171452874) has the molecular formula C55H41N and a molecular weight of 723.99 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-5-naphthalen-2-yl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline.
| Compound Name | 2,3,4,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-5-naphthalen-2-yl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 171452874 |
| Molecular Formula | C55H41N |
| Molecular Weight | 723.99 g/mol |
| Exact Mass | 723.37 |
| IUPAC Name | 2,3,4,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-5-naphthalen-2-yl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(-c2ccc3ccccc3c2)c([2H])c(N(c2ccc(-c3cccc4c3C(C)(C)c3ccccc3-4)cc2)c2c([2H])c([2H])c(-c3cccc(-c4ccccc4)c3)c([2H])c2[2H])c1[2H] |
| InChI | InChI=1S/C55H41N/c1-55(2)53-24-9-8-21-51(53)52-23-12-22-50(54(52)55)41-29-33-48(34-30-41)56(49-20-11-19-45(37-49)46-26-25-39-15-6-7-16-42(39)36-46)47-31-27-40(28-32-47)44-18-10-17-43(35-44)38-13-4-3-5-14-38/h3-37H,1-2H3/i11D,19D,20D,27D,28D,31D,32D,37D |
| InChIKey | SCJRHBBSHHQFGI-AIVADKGRSA-N |
| XLogP | 15.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.99 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |