C49H37N — CID 171452241
2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline (PubChem CID 171452241) has the molecular formula C49H37N and a molecular weight of 651.92 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline.
| Compound Name | 2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 171452241 |
| Molecular Formula | C49H37N |
| Molecular Weight | 651.92 g/mol |
| Exact Mass | 651.37 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(-c2ccc3ccccc3c2)c([2H])c(N(c2c([2H])c([2H])c(-c3ccccc3)c([2H])c2[2H])c2c([2H])c([2H])c(-c3cccc4c3C(C)(C)c3ccccc3-4)c([2H])c2[2H])c1[2H] |
| InChI | InChI=1S/C49H37N/c1-49(2)47-21-9-8-18-45(47)46-20-11-19-44(48(46)49)37-26-30-42(31-27-37)50(41-28-24-36(25-29-41)34-12-4-3-5-13-34)43-17-10-16-39(33-43)40-23-22-35-14-6-7-15-38(35)32-40/h3-33H,1-2H3/i10D,16D,17D,24D,25D,26D,27D,28D,29D,30D,31D,33D |
| InChIKey | ICZWEMFJHFLZAN-SSOYBOKOSA-N |
| XLogP | 13.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.92 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |