C58H45N — CID 171450914
9,9-dimethyl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]fluoren-2-amine (PubChem CID 171450914) has the molecular formula C58H45N and a molecular weight of 764.05 g/mol. Its IUPAC name is 9,9-dimethyl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 171450914 |
| Molecular Formula | C58H45N |
| Molecular Weight | 764.05 g/mol |
| Exact Mass | 763.41 |
| IUPAC Name | 9,9-dimethyl-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-1-yl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(3-naphthalen-2-ylphenyl)phenyl]fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2c([2H])c([2H])c(-c3cccc4c3C(C)(C)c3ccccc3-4)c([2H])c2[2H])c([2H])c([2H])c1-c1cccc(-c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C58H45N/c1-57(2)53-21-9-7-17-49(53)51-34-33-47(37-55(51)57)59(46-31-27-40(28-32-46)48-19-12-20-52-50-18-8-10-22-54(50)58(3,4)56(48)52)45-29-25-39(26-30-45)42-15-11-16-43(35-42)44-24-23-38-13-5-6-14-41(38)36-44/h5-37H,1-4H3/i25D,26D,27D,28D,29D,30D,31D,32D |
| InChIKey | VGHOYOMFFSRDQA-MBQXCPDVSA-N |
| XLogP | 15.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.05 |
| LogP ≤ 5 | 15.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |