C44H31N — CID 171451985
2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-(4-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline (PubChem CID 171451985) has the molecular formula C44H31N and a molecular weight of 581.79 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-(4-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline.
| Compound Name | 2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-(4-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 171451985 |
| Molecular Formula | C44H31N |
| Molecular Weight | 581.79 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-(4-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(-c2ccc3ccccc3c2)c([2H])c(N(c2ccc(-c3cccc4ccccc34)cc2)c2c([2H])c([2H])c(-c3ccccc3)c([2H])c2[2H])c1[2H] |
| InChI | InChI=1S/C44H31N/c1-2-10-32(11-3-1)34-22-26-40(27-23-34)45(41-28-24-36(25-29-41)44-19-9-15-35-13-6-7-18-43(35)44)42-17-8-16-38(31-42)39-21-20-33-12-4-5-14-37(33)30-39/h1-31H/i8D,16D,17D,22D,23D,26D,27D,31D |
| InChIKey | BLBKIHATBMZXDB-VCOPRVELSA-N |
| XLogP | 12.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.79 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |