C40H29N — CID 171452597
2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-phenyl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline (PubChem CID 171452597) has the molecular formula C40H29N and a molecular weight of 531.73 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-phenyl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline.
| Compound Name | 2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-phenyl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 171452597 |
| Molecular Formula | C40H29N |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-phenyl-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(-c2cccc3ccccc23)c([2H])c(N(c2ccccc2)c2c([2H])c([2H])c(-c3cccc(-c4ccccc4)c3)c([2H])c2[2H])c1[2H] |
| InChI | InChI=1S/C40H29N/c1-3-12-30(13-4-1)33-16-9-17-34(28-33)31-24-26-37(27-25-31)41(36-19-5-2-6-20-36)38-21-10-18-35(29-38)40-23-11-15-32-14-7-8-22-39(32)40/h1-29H/i10D,18D,21D,24D,25D,26D,27D,29D |
| InChIKey | BTMPORLOKWJCLK-PSSZPQIMSA-N |
| XLogP | 11.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |