C46H33N — CID 171451876
2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-[4-(3-phenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline (PubChem CID 171451876) has the molecular formula C46H33N and a molecular weight of 612.86 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-[4-(3-phenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline.
| Compound Name | 2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-[4-(3-phenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 171451876 |
| Molecular Formula | C46H33N |
| Molecular Weight | 612.86 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-[4-(3-phenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3ccc(-c4cccc(-c5ccccc5)c4)cc3)c3c([2H])c([2H])c([2H])c(-c4cccc5ccccc45)c3[2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C46H33N/c1-3-12-34(13-4-1)36-24-28-42(29-25-36)47(44-21-10-20-41(33-44)46-23-11-17-38-16-7-8-22-45(38)46)43-30-26-37(27-31-43)40-19-9-18-39(32-40)35-14-5-2-6-15-35/h1-33H/i1D,3D,4D,10D,12D,13D,20D,21D,24D,25D,28D,29D,33D |
| InChIKey | HGROLWYNBOLBTN-WWTFDBEZSA-N |
| XLogP | 12.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.86 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |