C52H37N — CID 171451752
2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)-N-[4-(4-phenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline (PubChem CID 171451752) has the molecular formula C52H37N and a molecular weight of 688.95 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)-N-[4-(4-phenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)-N-[4-(4-phenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 171451752 |
| Molecular Formula | C52H37N |
| Molecular Weight | 688.95 g/mol |
| Exact Mass | 688.37 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-(3-naphthalen-1-ylphenyl)-N-[4-(4-phenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3ccc(-c4ccc(-c5ccccc5)cc4)cc3)c3c([2H])c([2H])c(-c4cccc(-c5cccc6ccccc56)c4)c([2H])c3[2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C52H37N/c1-3-11-38(12-4-1)40-21-23-41(24-22-40)43-27-33-49(34-28-43)53(48-31-25-42(26-32-48)39-13-5-2-6-14-39)50-35-29-44(30-36-50)46-17-9-18-47(37-46)52-20-10-16-45-15-7-8-19-51(45)52/h1-37H/i2D,5D,6D,13D,14D,25D,26D,29D,30D,31D,32D,35D,36D |
| InChIKey | APFQZIGDRCGPED-HTRIYLOXSA-N |
| XLogP | 14.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.95 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |