C38H27N — CID 171450965
N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)naphthalen-1-amine (PubChem CID 171450965) has the molecular formula C38H27N and a molecular weight of 505.69 g/mol. Its IUPAC name is N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)naphthalen-1-amine.
| Compound Name | N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 171450965 |
| Molecular Formula | C38H27N |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c(-c2ccc3ccccc3c2)c([2H])c(N(c2c([2H])c([2H])c(-c3ccccc3)c([2H])c2[2H])c2cccc3ccccc23)c1[2H] |
| InChI | InChI=1S/C38H27N/c1-2-10-28(11-3-1)30-22-24-35(25-23-30)39(38-19-9-15-31-13-6-7-18-37(31)38)36-17-8-16-33(27-36)34-21-20-29-12-4-5-14-32(29)26-34/h1-27H/i8D,16D,17D,22D,23D,24D,25D,27D |
| InChIKey | LGOZJIDKWQJZNN-ZFZKZBCFSA-N |
| XLogP | 10.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |