C38H27N — CID 171451530
N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphthalen-1-amine (PubChem CID 171451530) has the molecular formula C38H27N and a molecular weight of 510.72 g/mol. Its IUPAC name is N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphthalen-1-amine.
| Compound Name | N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 171451530 |
| Molecular Formula | C38H27N |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3c([2H])c([2H])c([2H])c(-c4ccc5ccccc5c4)c3[2H])c3cccc4ccccc34)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C38H27N/c1-2-10-28(11-3-1)30-22-24-35(25-23-30)39(38-19-9-15-31-13-6-7-18-37(31)38)36-17-8-16-33(27-36)34-21-20-29-12-4-5-14-32(29)26-34/h1-27H/i1D,2D,3D,8D,10D,11D,16D,17D,22D,23D,24D,25D,27D |
| InChIKey | LGOZJIDKWQJZNN-LLZMJOFVSA-N |
| XLogP | 10.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |