C53H37N — CID 171451854
9,9-diphenyl-N-(4-phenylphenyl)-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)fluoren-2-amine (PubChem CID 171451854) has the molecular formula C53H37N and a molecular weight of 691.91 g/mol. Its IUPAC name is 9,9-diphenyl-N-(4-phenylphenyl)-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)fluoren-2-amine.
| Compound Name | 9,9-diphenyl-N-(4-phenylphenyl)-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 171451854 |
| Molecular Formula | C53H37N |
| Molecular Weight | 691.91 g/mol |
| Exact Mass | 691.32 |
| IUPAC Name | 9,9-diphenyl-N-(4-phenylphenyl)-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(-c2cccc3ccccc23)c([2H])c(N(c2ccc(-c3ccccc3)cc2)c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c1[2H] |
| InChI | InChI=1S/C53H37N/c1-4-16-38(17-5-1)39-30-32-44(33-31-39)54(45-25-14-20-41(36-45)48-28-15-19-40-18-10-11-26-47(40)48)46-34-35-50-49-27-12-13-29-51(49)53(52(50)37-46,42-21-6-2-7-22-42)43-23-8-3-9-24-43/h1-37H/i14D,20D,25D,36D |
| InChIKey | GHMSRPHBYLQGAR-AGWYWLIVSA-N |
| XLogP | 14.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.91 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |