C59H39NS — CID 168767093
9,9-diphenyl-N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine (PubChem CID 168767093) has the molecular formula C59H39NS and a molecular weight of 802.08 g/mol. Its IUPAC name is 9,9-diphenyl-N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine.
| Compound Name | 9,9-diphenyl-N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 168767093 |
| Molecular Formula | C59H39NS |
| Molecular Weight | 802.08 g/mol |
| Exact Mass | 801.33 |
| IUPAC Name | 9,9-diphenyl-N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(-c2cccc3c2sc2ccccc23)c([2H])c(N(c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c2c([2H])c([2H])c(-c3cccc4ccccc34)c([2H])c2[2H])c1[2H] |
| InChI | InChI=1S/C59H39NS/c1-3-19-43(20-4-1)59(44-21-5-2-6-22-44)55-30-11-9-25-51(55)52-37-36-47(39-56(52)59)60(45-34-32-41(33-35-45)49-27-14-17-40-16-7-8-24-48(40)49)46-23-13-18-42(38-46)50-28-15-29-54-53-26-10-12-31-57(53)61-58(50)54/h1-39H/i13D,18D,23D,32D,33D,34D,35D,38D |
| InChIKey | CPRDDPPWOBVBAA-ZVFXXJQKSA-N |
| XLogP | 16.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.08 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |