C40H27NS — CID 168767653
2,3,4,5,6-pentadeuterio-N-(3-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)aniline (PubChem CID 168767653) has the molecular formula C40H27NS and a molecular weight of 562.78 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-N-(3-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)aniline.
| Compound Name | 2,3,4,5,6-pentadeuterio-N-(3-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)aniline |
|---|---|
| PubChem CID | 168767653 |
| Molecular Formula | C40H27NS |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-N-(3-dibenzothiophen-4-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2cccc(-c3cccc4c3sc3ccccc34)c2)c2c([2H])c([2H])c(-c3cccc4ccccc34)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C40H27NS/c1-2-14-31(15-3-1)41(32-25-23-29(24-26-32)35-19-9-12-28-11-4-5-17-34(28)35)33-16-8-13-30(27-33)36-20-10-21-38-37-18-6-7-22-39(37)42-40(36)38/h1-27H/i1D,2D,3D,14D,15D,23D,24D,25D,26D |
| InChIKey | VUEKTWBZVKRJSD-MBCHCZFHSA-N |
| XLogP | 12.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |