C56H37NS — CID 171451625
2,3,5,6-tetradeuterio-N-(4-dibenzothiophen-4-ylphenyl)-N,4-bis(4-naphthalen-1-ylphenyl)aniline (PubChem CID 171451625) has the molecular formula C56H37NS and a molecular weight of 760.01 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-(4-dibenzothiophen-4-ylphenyl)-N,4-bis(4-naphthalen-1-ylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-(4-dibenzothiophen-4-ylphenyl)-N,4-bis(4-naphthalen-1-ylphenyl)aniline |
|---|---|
| PubChem CID | 171451625 |
| Molecular Formula | C56H37NS |
| Molecular Weight | 760.01 g/mol |
| Exact Mass | 759.29 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-(4-dibenzothiophen-4-ylphenyl)-N,4-bis(4-naphthalen-1-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc4ccccc34)cc2)c2ccc(-c3cccc4c3sc3ccccc34)cc2)c([2H])c([2H])c1-c1ccc(-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C56H37NS/c1-3-14-48-40(10-1)12-7-17-50(48)42-24-22-38(23-25-42)39-26-32-45(33-27-39)57(46-34-28-43(29-35-46)51-18-8-13-41-11-2-4-15-49(41)51)47-36-30-44(31-37-47)52-19-9-20-54-53-16-5-6-21-55(53)58-56(52)54/h1-37H/i26D,27D,32D,33D |
| InChIKey | KCXKYYSMHBWUAD-SQQCOLCUSA-N |
| XLogP | 16.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.01 |
| LogP ≤ 5 | 16.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |