C50H33NS — CID 168767655
3-dibenzothiophen-4-yl-N-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-N-(4-naphthalen-1-ylphenyl)aniline (PubChem CID 168767655) has the molecular formula C50H33NS and a molecular weight of 686.93 g/mol. Its IUPAC name is 3-dibenzothiophen-4-yl-N-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-N-(4-naphthalen-1-ylphenyl)aniline.
| Compound Name | 3-dibenzothiophen-4-yl-N-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-N-(4-naphthalen-1-ylphenyl)aniline |
|---|---|
| PubChem CID | 168767655 |
| Molecular Formula | C50H33NS |
| Molecular Weight | 686.93 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | 3-dibenzothiophen-4-yl-N-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-N-(4-naphthalen-1-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc(N(c4ccc(-c5cccc6ccccc56)cc4)c4cccc(-c5cccc6c5sc5ccccc56)c4)cc3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C50H33NS/c1-3-17-42-34(11-1)13-8-20-44(42)36-25-29-39(30-26-36)51(40-31-27-37(28-32-40)45-21-9-14-35-12-2-4-18-43(35)45)41-16-7-15-38(33-41)46-22-10-23-48-47-19-5-6-24-49(47)52-50(46)48/h1-33H/i1D,3D,8D,11D,13D,17D,20D |
| InChIKey | VRUKFZXQWSSRAX-MUSXDCATSA-N |
| XLogP | 14.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.93 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |