C47H35N — CID 171452264
9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine (PubChem CID 171452264) has the molecular formula C47H35N and a molecular weight of 621.85 g/mol. Its IUPAC name is 9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 171452264 |
| Molecular Formula | C47H35N |
| Molecular Weight | 621.85 g/mol |
| Exact Mass | 621.33 |
| IUPAC Name | 9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(-c2cccc3ccccc23)c([2H])c(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2c([2H])c([2H])c(-c3cccc4ccccc34)c([2H])c2[2H])c1[2H] |
| InChI | InChI=1S/C47H35N/c1-47(2)45-23-8-7-20-43(45)44-29-28-38(31-46(44)47)48(36-26-24-34(25-27-36)41-21-10-14-32-12-3-5-18-39(32)41)37-17-9-16-35(30-37)42-22-11-15-33-13-4-6-19-40(33)42/h3-31H,1-2H3/i9D,16D,17D,24D,25D,26D,27D,30D |
| InChIKey | ILVHXJZCTLSMEV-LFNRNLABSA-N |
| XLogP | 13.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.85 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |