C54H37NS — CID 168767521
9-methyl-9-phenyl-N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-2-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine (PubChem CID 168767521) has the molecular formula C54H37NS and a molecular weight of 740.01 g/mol. Its IUPAC name is 9-methyl-9-phenyl-N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-2-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine.
| Compound Name | 9-methyl-9-phenyl-N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-2-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 168767521 |
| Molecular Formula | C54H37NS |
| Molecular Weight | 740.01 g/mol |
| Exact Mass | 739.31 |
| IUPAC Name | 9-methyl-9-phenyl-N-(2,3,4,6-tetradeuterio-5-dibenzothiophen-2-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(-c2ccc3sc4ccccc4c3c2)c([2H])c(N(c2ccc3c(c2)C(C)(c2ccccc2)c2ccccc2-3)c2c([2H])c([2H])c(-c3cccc4ccccc34)c([2H])c2[2H])c1[2H] |
| InChI | InChI=1S/C54H37NS/c1-54(40-16-3-2-4-17-40)50-23-9-7-20-46(50)47-31-30-43(35-51(47)54)55(41-28-25-37(26-29-41)45-22-12-14-36-13-5-6-19-44(36)45)42-18-11-15-38(33-42)39-27-32-53-49(34-39)48-21-8-10-24-52(48)56-53/h2-35H,1H3/i11D,15D,18D,25D,26D,28D,29D,33D |
| InChIKey | AUSPRTISWVOSHY-BBBGZGPTSA-N |
| XLogP | 15.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.01 |
| LogP ≤ 5 | 15.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |