C44H29N — CID 171452706
N-phenanthren-2-yl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)phenanthren-2-amine (PubChem CID 171452706) has the molecular formula C44H29N and a molecular weight of 575.75 g/mol. Its IUPAC name is N-phenanthren-2-yl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)phenanthren-2-amine.
| Compound Name | N-phenanthren-2-yl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)phenanthren-2-amine |
|---|---|
| PubChem CID | 171452706 |
| Molecular Formula | C44H29N |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | N-phenanthren-2-yl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)phenanthren-2-amine |
| SMILES | [2H]c1c([2H])c(-c2cccc3ccccc23)c([2H])c(N(c2ccc3c(ccc4ccccc43)c2)c2ccc3c(ccc4ccccc43)c2)c1[2H] |
| InChI | InChI=1S/C44H29N/c1-4-15-39-30(9-1)12-8-18-42(39)33-13-7-14-36(27-33)45(37-23-25-43-34(28-37)21-19-31-10-2-5-16-40(31)43)38-24-26-44-35(29-38)22-20-32-11-3-6-17-41(32)44/h1-29H/i7D,13D,14D,27D |
| InChIKey | ILSHZLIDPUCAKJ-BYOIXOJOSA-N |
| XLogP | 12.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|