C63H43N — CID 153471240
9,9-diphenyl-N-[4-(3-phenylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)fluoren-2-amine (PubChem CID 153471240) has the molecular formula C63H43N and a molecular weight of 818.07 g/mol. Its IUPAC name is 9,9-diphenyl-N-[4-(3-phenylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)fluoren-2-amine.
| Compound Name | 9,9-diphenyl-N-[4-(3-phenylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 153471240 |
| Molecular Formula | C63H43N |
| Molecular Weight | 818.07 g/mol |
| Exact Mass | 817.36 |
| IUPAC Name | 9,9-diphenyl-N-[4-(3-phenylphenyl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenanthren-9-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc(-c4ccccc4)c3)cc2)c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c([2H])c([2H])c1-c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C63H43N/c1-4-17-44(18-5-1)47-20-16-21-48(41-47)45-31-35-52(36-32-45)64(53-37-33-46(34-38-53)60-42-49-19-10-11-26-55(49)56-27-12-13-28-57(56)60)54-39-40-59-58-29-14-15-30-61(58)63(62(59)43-54,50-22-6-2-7-23-50)51-24-8-3-9-25-51/h1-43H/i33D,34D,37D,38D |
| InChIKey | LMHQRWCSWYTBNF-GEBLEHJMSA-N |
| XLogP | 16.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.07 |
| LogP ≤ 5 | 16.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|