C63H43N — CID 153471387
N-(4-phenanthren-9-ylphenyl)-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-phenylphenyl)phenyl]fluoren-2-amine (PubChem CID 153471387) has the molecular formula C63H43N and a molecular weight of 822.09 g/mol. Its IUPAC name is N-(4-phenanthren-9-ylphenyl)-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-phenylphenyl)phenyl]fluoren-2-amine.
| Compound Name | N-(4-phenanthren-9-ylphenyl)-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-phenylphenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 153471387 |
| Molecular Formula | C63H43N |
| Molecular Weight | 822.09 g/mol |
| Exact Mass | 821.39 |
| IUPAC Name | N-(4-phenanthren-9-ylphenyl)-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-phenylphenyl)phenyl]fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(-c2c([2H])c([2H])c(N(c3ccc(-c4cc5ccccc5c5ccccc45)cc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)c([2H])c2[2H])c([2H])c([2H])c1-c1ccccc1 |
| InChI | InChI=1S/C63H43N/c1-4-16-44(17-5-1)45-28-30-46(31-29-45)47-32-36-52(37-33-47)64(53-38-34-48(35-39-53)60-42-49-18-10-11-23-55(49)56-24-12-13-25-57(56)60)54-40-41-59-58-26-14-15-27-61(58)63(62(59)43-54,50-19-6-2-7-20-50)51-21-8-3-9-22-51/h1-43H/i28D,29D,30D,31D,32D,33D,36D,37D |
| InChIKey | TYNCSGBYOCSPCE-NXQYGHHMSA-N |
| XLogP | 16.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.09 |
| LogP ≤ 5 | 16.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|