C41H31N — CID 171451041
N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)fluoren-2-amine (PubChem CID 171451041) has the molecular formula C41H31N and a molecular weight of 548.77 g/mol. Its IUPAC name is N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)fluoren-2-amine.
| Compound Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 171451041 |
| Molecular Formula | C41H31N |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | N-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-9,9-dimethyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-2-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(-c2ccc3ccccc3c2)c([2H])c(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c1[2H] |
| InChI | InChI=1S/C41H31N/c1-41(2)38-19-8-7-18-36(38)37-24-23-34(27-39(37)41)42(40-20-10-14-29-12-5-6-17-35(29)40)33-16-9-15-31(26-33)32-22-21-28-11-3-4-13-30(28)25-32/h3-27H,1-2H3/i5D,6D,9D,10D,12D,14D,15D,16D,17D,20D,26D |
| InChIKey | MZXLTQRXSDHAJT-AUKKMTNDSA-N |
| XLogP | 11.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |