C50H33NO — CID 167330058
2,3,4,5,6,7,8-heptadeuterio-N-(4-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-N-[4-(3-phenylphenyl)phenyl]naphthalen-1-amine (PubChem CID 167330058) has the molecular formula C50H33NO and a molecular weight of 670.86 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterio-N-(4-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-N-[4-(3-phenylphenyl)phenyl]naphthalen-1-amine.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterio-N-(4-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-N-[4-(3-phenylphenyl)phenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 167330058 |
| Molecular Formula | C50H33NO |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterio-N-(4-naphtho[1,2-b][1]benzofuran-7-ylphenyl)-N-[4-(3-phenylphenyl)phenyl]naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(N(c3ccc(-c4cccc(-c5ccccc5)c4)cc3)c3ccc(-c4cccc5oc6c7ccccc7ccc6c45)cc3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C50H33NO/c1-2-11-34(12-3-1)39-16-8-17-40(33-39)35-23-28-41(29-24-35)51(47-21-9-15-36-13-4-6-18-43(36)47)42-30-25-38(26-31-42)44-20-10-22-48-49(44)46-32-27-37-14-5-7-19-45(37)50(46)52-48/h1-33H/i4D,6D,9D,13D,15D,18D,21D |
| InChIKey | XBZDNBMOHPEDPT-YMSYLSHCSA-N |
| XLogP | 14.36 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |